C23H24BrNO3 — CID 2968147
5-bromo-3-hydroxy-3-[2-oxo-2-(2,3,5,6-tetramethylphenyl)ethyl]-1-prop-2-enylindol-2-one (PubChem CID 2968147) has the molecular formula C23H24BrNO3 and a molecular weight of 442.35 g/mol. Its IUPAC name is 5-bromo-3-hydroxy-3-[2-oxo-2-(2,3,5,6-tetramethylphenyl)ethyl]-1-prop-2-enylindol-2-one.
| Compound Name | 5-bromo-3-hydroxy-3-[2-oxo-2-(2,3,5,6-tetramethylphenyl)ethyl]-1-prop-2-enylindol-2-one |
|---|---|
| PubChem CID | 2968147 |
| Molecular Formula | C23H24BrNO3 |
| Molecular Weight | 442.35 g/mol |
| Exact Mass | 441.09 |
| IUPAC Name | 5-bromo-3-hydroxy-3-[2-oxo-2-(2,3,5,6-tetramethylphenyl)ethyl]-1-prop-2-enylindol-2-one |
| SMILES | C=CCN1C(=O)C(O)(CC(=O)c2c(C)c(C)cc(C)c2C)c2cc(Br)ccc21 |
| InChI | InChI=1S/C23H24BrNO3/c1-6-9-25-19-8-7-17(24)11-18(19)23(28,22(25)27)12-20(26)21-15(4)13(2)10-14(3)16(21)5/h6-8,10-11,28H,1,9,12H2,2-5H3 |
| InChIKey | SZMKVRVDUMFUAH-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.35 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|