C18H16BrNO3S — CID 1266799
(3R)-5-bromo-3-hydroxy-3-[2-(5-methylthiophen-2-yl)-2-oxoethyl]-1-prop-2-enylindol-2-one (PubChem CID 1266799) has the molecular formula C18H16BrNO3S and a molecular weight of 406.30 g/mol. Its IUPAC name is (3R)-5-bromo-3-hydroxy-3-[2-(5-methylthiophen-2-yl)-2-oxoethyl]-1-prop-2-enylindol-2-one.
| Compound Name | (3R)-5-bromo-3-hydroxy-3-[2-(5-methylthiophen-2-yl)-2-oxoethyl]-1-prop-2-enylindol-2-one |
|---|---|
| PubChem CID | 1266799 |
| Molecular Formula | C18H16BrNO3S |
| Molecular Weight | 406.30 g/mol |
| Exact Mass | 405.00 |
| IUPAC Name | (3R)-5-bromo-3-hydroxy-3-[2-(5-methylthiophen-2-yl)-2-oxoethyl]-1-prop-2-enylindol-2-one |
| SMILES | C=CCN1C(=O)[C@@](O)(CC(=O)c2ccc(C)s2)c2cc(Br)ccc21 |
| InChI | InChI=1S/C18H16BrNO3S/c1-3-8-20-14-6-5-12(19)9-13(14)18(23,17(20)22)10-15(21)16-7-4-11(2)24-16/h3-7,9,23H,1,8,10H2,2H3/t18-/m1/s1 |
| InChIKey | KAYXSDUAXZKGKY-GOSISDBHSA-N |
| XLogP | 3.81 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.30 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|