C18H18BrNO3S — CID 5235892
5-bromo-3-hydroxy-3-[2-(5-methylthiophen-2-yl)-2-oxoethyl]-1-propylindol-2-one (PubChem CID 5235892) has the molecular formula C18H18BrNO3S and a molecular weight of 408.32 g/mol. Its IUPAC name is 5-bromo-3-hydroxy-3-[2-(5-methylthiophen-2-yl)-2-oxoethyl]-1-propylindol-2-one.
| Compound Name | 5-bromo-3-hydroxy-3-[2-(5-methylthiophen-2-yl)-2-oxoethyl]-1-propylindol-2-one |
|---|---|
| PubChem CID | 5235892 |
| Molecular Formula | C18H18BrNO3S |
| Molecular Weight | 408.32 g/mol |
| Exact Mass | 407.02 |
| IUPAC Name | 5-bromo-3-hydroxy-3-[2-(5-methylthiophen-2-yl)-2-oxoethyl]-1-propylindol-2-one |
| SMILES | CCCN1C(=O)C(O)(CC(=O)c2ccc(C)s2)c2cc(Br)ccc21 |
| InChI | InChI=1S/C18H18BrNO3S/c1-3-8-20-14-6-5-12(19)9-13(14)18(23,17(20)22)10-15(21)16-7-4-11(2)24-16/h4-7,9,23H,3,8,10H2,1-2H3 |
| InChIKey | GMIWJMVYDJPENY-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.32 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |