C19H20BrNO3S — CID 40873861
(3S)-5-bromo-1-butyl-3-hydroxy-3-[2-(5-methylthiophen-2-yl)-2-oxoethyl]indol-2-one (PubChem CID 40873861) has the molecular formula C19H20BrNO3S and a molecular weight of 422.34 g/mol. Its IUPAC name is (3S)-5-bromo-1-butyl-3-hydroxy-3-[2-(5-methylthiophen-2-yl)-2-oxoethyl]indol-2-one.
| Compound Name | (3S)-5-bromo-1-butyl-3-hydroxy-3-[2-(5-methylthiophen-2-yl)-2-oxoethyl]indol-2-one |
|---|---|
| PubChem CID | 40873861 |
| Molecular Formula | C19H20BrNO3S |
| Molecular Weight | 422.34 g/mol |
| Exact Mass | 421.03 |
| IUPAC Name | (3S)-5-bromo-1-butyl-3-hydroxy-3-[2-(5-methylthiophen-2-yl)-2-oxoethyl]indol-2-one |
| SMILES | CCCCN1C(=O)[C@](O)(CC(=O)c2ccc(C)s2)c2cc(Br)ccc21 |
| InChI | InChI=1S/C19H20BrNO3S/c1-3-4-9-21-15-7-6-13(20)10-14(15)19(24,18(21)23)11-16(22)17-8-5-12(2)25-17/h5-8,10,24H,3-4,9,11H2,1-2H3/t19-/m0/s1 |
| InChIKey | WDLWRRZQAYOENL-IBGZPJMESA-N |
| XLogP | 4.43 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.34 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |