C20H19BrINO3 — CID 3419310
5-bromo-1-butyl-3-hydroxy-3-[2-(4-iodophenyl)-2-oxoethyl]indol-2-one (PubChem CID 3419310) has the molecular formula C20H19BrINO3 and a molecular weight of 528.18 g/mol. Its IUPAC name is 5-bromo-1-butyl-3-hydroxy-3-[2-(4-iodophenyl)-2-oxoethyl]indol-2-one.
| Compound Name | 5-bromo-1-butyl-3-hydroxy-3-[2-(4-iodophenyl)-2-oxoethyl]indol-2-one |
|---|---|
| PubChem CID | 3419310 |
| Molecular Formula | C20H19BrINO3 |
| Molecular Weight | 528.18 g/mol |
| Exact Mass | 526.96 |
| IUPAC Name | 5-bromo-1-butyl-3-hydroxy-3-[2-(4-iodophenyl)-2-oxoethyl]indol-2-one |
| SMILES | CCCCN1C(=O)C(O)(CC(=O)c2ccc(I)cc2)c2cc(Br)ccc21 |
| InChI | InChI=1S/C20H19BrINO3/c1-2-3-10-23-17-9-6-14(21)11-16(17)20(26,19(23)25)12-18(24)13-4-7-15(22)8-5-13/h4-9,11,26H,2-3,10,12H2,1H3 |
| InChIKey | NRTKBXXHCXIJEY-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.18 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|