C23H17BrINO3 — CID 98168699
(3R)-1-benzyl-5-bromo-3-hydroxy-3-[2-(4-iodophenyl)-2-oxoethyl]indol-2-one (PubChem CID 98168699) has the molecular formula C23H17BrINO3 and a molecular weight of 562.20 g/mol. Its IUPAC name is (3R)-1-benzyl-5-bromo-3-hydroxy-3-[2-(4-iodophenyl)-2-oxoethyl]indol-2-one.
| Compound Name | (3R)-1-benzyl-5-bromo-3-hydroxy-3-[2-(4-iodophenyl)-2-oxoethyl]indol-2-one |
|---|---|
| PubChem CID | 98168699 |
| Molecular Formula | C23H17BrINO3 |
| Molecular Weight | 562.20 g/mol |
| Exact Mass | 560.94 |
| IUPAC Name | (3R)-1-benzyl-5-bromo-3-hydroxy-3-[2-(4-iodophenyl)-2-oxoethyl]indol-2-one |
| SMILES | O=C(C[C@]1(O)C(=O)N(Cc2ccccc2)c2ccc(Br)cc21)c1ccc(I)cc1 |
| InChI | InChI=1S/C23H17BrINO3/c24-17-8-11-20-19(12-17)23(29,13-21(27)16-6-9-18(25)10-7-16)22(28)26(20)14-15-4-2-1-3-5-15/h1-12,29H,13-14H2/t23-/m1/s1 |
| InChIKey | HMSWCDIDMZWNIW-HSZRJFAPSA-N |
| XLogP | 5.06 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.20 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|