C16H14BrNO3 — CID 102334862
1-benzyl-5-bromo-3-hydroxy-3-(hydroxymethyl)indol-2-one (PubChem CID 102334862) has the molecular formula C16H14BrNO3 and a molecular weight of 348.20 g/mol. Its IUPAC name is 1-benzyl-5-bromo-3-hydroxy-3-(hydroxymethyl)indol-2-one.
| Compound Name | 1-benzyl-5-bromo-3-hydroxy-3-(hydroxymethyl)indol-2-one |
|---|---|
| PubChem CID | 102334862 |
| Molecular Formula | C16H14BrNO3 |
| Molecular Weight | 348.20 g/mol |
| Exact Mass | 347.02 |
| IUPAC Name | 1-benzyl-5-bromo-3-hydroxy-3-(hydroxymethyl)indol-2-one |
| SMILES | O=C1N(Cc2ccccc2)c2ccc(Br)cc2C1(O)CO |
| InChI | InChI=1S/C16H14BrNO3/c17-12-6-7-14-13(8-12)16(21,10-19)15(20)18(14)9-11-4-2-1-3-5-11/h1-8,19,21H,9-10H2 |
| InChIKey | IQGBFVXUJKCVGY-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.20 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |