C15H10BrF2NO — CID 102306574
1-benzyl-5-bromo-3,3-difluoroindol-2-one (PubChem CID 102306574) has the molecular formula C15H10BrF2NO and a molecular weight of 338.15 g/mol. Its IUPAC name is 1-benzyl-5-bromo-3,3-difluoroindol-2-one.
| Compound Name | 1-benzyl-5-bromo-3,3-difluoroindol-2-one |
|---|---|
| PubChem CID | 102306574 |
| Molecular Formula | C15H10BrF2NO |
| Molecular Weight | 338.15 g/mol |
| Exact Mass | 336.99 |
| IUPAC Name | 1-benzyl-5-bromo-3,3-difluoroindol-2-one |
| SMILES | O=C1N(Cc2ccccc2)c2ccc(Br)cc2C1(F)F |
| InChI | InChI=1S/C15H10BrF2NO/c16-11-6-7-13-12(8-11)15(17,18)14(20)19(13)9-10-4-2-1-3-5-10/h1-8H,9H2 |
| InChIKey | PNEOTQFEJYDFAP-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.15 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |