C20H21BrN2O5 — CID 132821898
tert-butyl N-[(3S)-1-benzyl-5-bromo-3-hydroperoxy-2-oxoindol-3-yl]carbamate (PubChem CID 132821898) has the molecular formula C20H21BrN2O5 and a molecular weight of 449.30 g/mol. Its IUPAC name is tert-butyl N-[(3S)-1-benzyl-5-bromo-3-hydroperoxy-2-oxoindol-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3S)-1-benzyl-5-bromo-3-hydroperoxy-2-oxoindol-3-yl]carbamate |
|---|---|
| PubChem CID | 132821898 |
| Molecular Formula | C20H21BrN2O5 |
| Molecular Weight | 449.30 g/mol |
| Exact Mass | 448.06 |
| IUPAC Name | tert-butyl N-[(3S)-1-benzyl-5-bromo-3-hydroperoxy-2-oxoindol-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@]1(OO)C(=O)N(Cc2ccccc2)c2ccc(Br)cc21 |
| InChI | InChI=1S/C20H21BrN2O5/c1-19(2,3)27-18(25)22-20(28-26)15-11-14(21)9-10-16(15)23(17(20)24)12-13-7-5-4-6-8-13/h4-11,26H,12H2,1-3H3,(H,22,25)/t20-/m0/s1 |
| InChIKey | BMNSXUDFCSIFCQ-FQEVSTJZSA-N |
| XLogP | 4.16 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.30 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|