C16H18F3N3O4 — CID 97489697
tert-butyl N-[(4S)-1-benzyl-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]carbamate (PubChem CID 97489697) has the molecular formula C16H18F3N3O4 and a molecular weight of 373.33 g/mol. Its IUPAC name is tert-butyl N-[(4S)-1-benzyl-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]carbamate.
| Compound Name | tert-butyl N-[(4S)-1-benzyl-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]carbamate |
|---|---|
| PubChem CID | 97489697 |
| Molecular Formula | C16H18F3N3O4 |
| Molecular Weight | 373.33 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | tert-butyl N-[(4S)-1-benzyl-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@]1(C(F)(F)F)NC(=O)N(Cc2ccccc2)C1=O |
| InChI | InChI=1S/C16H18F3N3O4/c1-14(2,3)26-13(25)21-15(16(17,18)19)11(23)22(12(24)20-15)9-10-7-5-4-6-8-10/h4-8H,9H2,1-3H3,(H,20,24)(H,21,25)/t15-/m0/s1 |
| InChIKey | GKPQYLQBVFRUNK-HNNXBMFYSA-N |
| XLogP | 2.52 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.33 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|