C18H13F4N3O3 — CID 3836618
N-[1-benzyl-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]-4-fluorobenzamide (PubChem CID 3836618) has the molecular formula C18H13F4N3O3 and a molecular weight of 395.31 g/mol. Its IUPAC name is N-[1-benzyl-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]-4-fluorobenzamide.
| Compound Name | N-[1-benzyl-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 3836618 |
| Molecular Formula | C18H13F4N3O3 |
| Molecular Weight | 395.31 g/mol |
| Exact Mass | 395.09 |
| IUPAC Name | N-[1-benzyl-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]-4-fluorobenzamide |
| SMILES | O=C(NC1(C(F)(F)F)NC(=O)N(Cc2ccccc2)C1=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C18H13F4N3O3/c19-13-8-6-12(7-9-13)14(26)23-17(18(20,21)22)15(27)25(16(28)24-17)10-11-4-2-1-3-5-11/h1-9H,10H2,(H,23,26)(H,24,28) |
| InChIKey | OJPZISJWDCTKFN-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.31 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|