C18H15F3N4O5S — CID 4904947
N-[2,5-dioxo-1-[(4-sulfamoylphenyl)methyl]-4-(trifluoromethyl)imidazolidin-4-yl]benzamide (PubChem CID 4904947) has the molecular formula C18H15F3N4O5S and a molecular weight of 456.40 g/mol. Its IUPAC name is N-[2,5-dioxo-1-[(4-sulfamoylphenyl)methyl]-4-(trifluoromethyl)imidazolidin-4-yl]benzamide.
| Compound Name | N-[2,5-dioxo-1-[(4-sulfamoylphenyl)methyl]-4-(trifluoromethyl)imidazolidin-4-yl]benzamide |
|---|---|
| PubChem CID | 4904947 |
| Molecular Formula | C18H15F3N4O5S |
| Molecular Weight | 456.40 g/mol |
| Exact Mass | 456.07 |
| IUPAC Name | N-[2,5-dioxo-1-[(4-sulfamoylphenyl)methyl]-4-(trifluoromethyl)imidazolidin-4-yl]benzamide |
| SMILES | NS(=O)(=O)c1ccc(CN2C(=O)NC(NC(=O)c3ccccc3)(C(F)(F)F)C2=O)cc1 |
| InChI | InChI=1S/C18H15F3N4O5S/c19-18(20,21)17(23-14(26)12-4-2-1-3-5-12)15(27)25(16(28)24-17)10-11-6-8-13(9-7-11)31(22,29)30/h1-9H,10H2,(H,23,26)(H,24,28)(H2,22,29,30) |
| InChIKey | FGEWINLWCSRYDK-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 138.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.40 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|