C20H18F3N3O5 — CID 3815407
3-methoxy-N-[1-[(4-methoxyphenyl)methyl]-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]benzamide (PubChem CID 3815407) has the molecular formula C20H18F3N3O5 and a molecular weight of 437.37 g/mol. Its IUPAC name is 3-methoxy-N-[1-[(4-methoxyphenyl)methyl]-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]benzamide.
| Compound Name | 3-methoxy-N-[1-[(4-methoxyphenyl)methyl]-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]benzamide |
|---|---|
| PubChem CID | 3815407 |
| Molecular Formula | C20H18F3N3O5 |
| Molecular Weight | 437.37 g/mol |
| Exact Mass | 437.12 |
| IUPAC Name | 3-methoxy-N-[1-[(4-methoxyphenyl)methyl]-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]benzamide |
| SMILES | COc1ccc(CN2C(=O)NC(NC(=O)c3cccc(OC)c3)(C(F)(F)F)C2=O)cc1 |
| InChI | InChI=1S/C20H18F3N3O5/c1-30-14-8-6-12(7-9-14)11-26-17(28)19(20(21,22)23,25-18(26)29)24-16(27)13-4-3-5-15(10-13)31-2/h3-10H,11H2,1-2H3,(H,24,27)(H,25,29) |
| InChIKey | JECNJRRXHPHOFV-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.37 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|