C19H13F6N3O3 — CID 2010336
N-[(4R)-1-benzyl-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]-3-(trifluoromethyl)benzamide (PubChem CID 2010336) has the molecular formula C19H13F6N3O3 and a molecular weight of 445.32 g/mol. Its IUPAC name is N-[(4R)-1-benzyl-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]-3-(trifluoromethyl)benzamide.
| Compound Name | N-[(4R)-1-benzyl-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 2010336 |
| Molecular Formula | C19H13F6N3O3 |
| Molecular Weight | 445.32 g/mol |
| Exact Mass | 445.09 |
| IUPAC Name | N-[(4R)-1-benzyl-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]-3-(trifluoromethyl)benzamide |
| SMILES | O=C(N[C@@]1(C(F)(F)F)NC(=O)N(Cc2ccccc2)C1=O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H13F6N3O3/c20-18(21,22)13-8-4-7-12(9-13)14(29)26-17(19(23,24)25)15(30)28(16(31)27-17)10-11-5-2-1-3-6-11/h1-9H,10H2,(H,26,29)(H,27,31)/t17-/m1/s1 |
| InChIKey | MPFZGPWAVMEACJ-QGZVFWFLSA-N |
| XLogP | 3.45 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.32 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|