C21H20F3N3O6 — CID 2216992
N-[(4S)-1-benzyl-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]-3,4,5-trimethoxybenzamide (PubChem CID 2216992) has the molecular formula C21H20F3N3O6 and a molecular weight of 467.40 g/mol. Its IUPAC name is N-[(4S)-1-benzyl-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[(4S)-1-benzyl-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 2216992 |
| Molecular Formula | C21H20F3N3O6 |
| Molecular Weight | 467.40 g/mol |
| Exact Mass | 467.13 |
| IUPAC Name | N-[(4S)-1-benzyl-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(C(=O)N[C@]2(C(F)(F)F)NC(=O)N(Cc3ccccc3)C2=O)cc(OC)c1OC |
| InChI | InChI=1S/C21H20F3N3O6/c1-31-14-9-13(10-15(32-2)16(14)33-3)17(28)25-20(21(22,23)24)18(29)27(19(30)26-20)11-12-7-5-4-6-8-12/h4-10H,11H2,1-3H3,(H,25,28)(H,26,30)/t20-/m0/s1 |
| InChIKey | GVHWGBVCCQHAEA-FQEVSTJZSA-N |
| XLogP | 2.45 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.40 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|