C21H20F3N3O5 — CID 2962074
N-[1-[2-(3,4-dimethoxyphenyl)ethyl]-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]benzamide (PubChem CID 2962074) has the molecular formula C21H20F3N3O5 and a molecular weight of 451.40 g/mol. Its IUPAC name is N-[1-[2-(3,4-dimethoxyphenyl)ethyl]-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]benzamide.
| Compound Name | N-[1-[2-(3,4-dimethoxyphenyl)ethyl]-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]benzamide |
|---|---|
| PubChem CID | 2962074 |
| Molecular Formula | C21H20F3N3O5 |
| Molecular Weight | 451.40 g/mol |
| Exact Mass | 451.14 |
| IUPAC Name | N-[1-[2-(3,4-dimethoxyphenyl)ethyl]-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]benzamide |
| SMILES | COc1ccc(CCN2C(=O)NC(NC(=O)c3ccccc3)(C(F)(F)F)C2=O)cc1OC |
| InChI | InChI=1S/C21H20F3N3O5/c1-31-15-9-8-13(12-16(15)32-2)10-11-27-18(29)20(21(22,23)24,26-19(27)30)25-17(28)14-6-4-3-5-7-14/h3-9,12H,10-11H2,1-2H3,(H,25,28)(H,26,30) |
| InChIKey | CEPYVSZVLDSRRK-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.40 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|