C22H22F3N3O6 — CID 40936967
N-[(4S)-1-[2-(3,4-dimethoxyphenyl)ethyl]-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]-2-methoxybenzamide (PubChem CID 40936967) has the molecular formula C22H22F3N3O6 and a molecular weight of 481.43 g/mol. Its IUPAC name is N-[(4S)-1-[2-(3,4-dimethoxyphenyl)ethyl]-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]-2-methoxybenzamide.
| Compound Name | N-[(4S)-1-[2-(3,4-dimethoxyphenyl)ethyl]-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 40936967 |
| Molecular Formula | C22H22F3N3O6 |
| Molecular Weight | 481.43 g/mol |
| Exact Mass | 481.15 |
| IUPAC Name | N-[(4S)-1-[2-(3,4-dimethoxyphenyl)ethyl]-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]-2-methoxybenzamide |
| SMILES | COc1ccc(CCN2C(=O)N[C@](NC(=O)c3ccccc3OC)(C(F)(F)F)C2=O)cc1OC |
| InChI | InChI=1S/C22H22F3N3O6/c1-32-15-7-5-4-6-14(15)18(29)26-21(22(23,24)25)19(30)28(20(31)27-21)11-10-13-8-9-16(33-2)17(12-13)34-3/h4-9,12H,10-11H2,1-3H3,(H,26,29)(H,27,31)/t21-/m0/s1 |
| InChIKey | PEKANPMKPYNHGK-NRFANRHFSA-N |
| XLogP | 2.50 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.43 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|