C21H26F3N3O6 — CID 3294101
N-[1-(cyclohexylmethyl)-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]-2,3,4-trimethoxybenzamide (PubChem CID 3294101) has the molecular formula C21H26F3N3O6 and a molecular weight of 473.45 g/mol. Its IUPAC name is N-[1-(cyclohexylmethyl)-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]-2,3,4-trimethoxybenzamide.
| Compound Name | N-[1-(cyclohexylmethyl)-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]-2,3,4-trimethoxybenzamide |
|---|---|
| PubChem CID | 3294101 |
| Molecular Formula | C21H26F3N3O6 |
| Molecular Weight | 473.45 g/mol |
| Exact Mass | 473.18 |
| IUPAC Name | N-[1-(cyclohexylmethyl)-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]-2,3,4-trimethoxybenzamide |
| SMILES | COc1ccc(C(=O)NC2(C(F)(F)F)NC(=O)N(CC3CCCCC3)C2=O)c(OC)c1OC |
| InChI | InChI=1S/C21H26F3N3O6/c1-31-14-10-9-13(15(32-2)16(14)33-3)17(28)25-20(21(22,23)24)18(29)27(19(30)26-20)11-12-7-5-4-6-8-12/h9-10,12H,4-8,11H2,1-3H3,(H,25,28)(H,26,30) |
| InChIKey | CDSHPZDBZVXDMN-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.45 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|