C20H18F3N3O4 — CID 2968794
N-[1-(3,4-dimethylphenyl)-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]-2-methoxybenzamide (PubChem CID 2968794) has the molecular formula C20H18F3N3O4 and a molecular weight of 421.38 g/mol. Its IUPAC name is N-[1-(3,4-dimethylphenyl)-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]-2-methoxybenzamide.
| Compound Name | N-[1-(3,4-dimethylphenyl)-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 2968794 |
| Molecular Formula | C20H18F3N3O4 |
| Molecular Weight | 421.38 g/mol |
| Exact Mass | 421.12 |
| IUPAC Name | N-[1-(3,4-dimethylphenyl)-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]-2-methoxybenzamide |
| SMILES | COc1ccccc1C(=O)NC1(C(F)(F)F)NC(=O)N(c2ccc(C)c(C)c2)C1=O |
| InChI | InChI=1S/C20H18F3N3O4/c1-11-8-9-13(10-12(11)2)26-17(28)19(20(21,22)23,25-18(26)29)24-16(27)14-6-4-5-7-15(14)30-3/h4-10H,1-3H3,(H,24,27)(H,25,29) |
| InChIKey | SDNWNBWHOSOZSW-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.38 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|