C17H10F5N3O3 — CID 46500658
4-fluoro-N-[1-(4-fluorophenyl)-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]benzamide (PubChem CID 46500658) has the molecular formula C17H10F5N3O3 and a molecular weight of 399.28 g/mol. Its IUPAC name is 4-fluoro-N-[1-(4-fluorophenyl)-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]benzamide.
| Compound Name | 4-fluoro-N-[1-(4-fluorophenyl)-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]benzamide |
|---|---|
| PubChem CID | 46500658 |
| Molecular Formula | C17H10F5N3O3 |
| Molecular Weight | 399.28 g/mol |
| Exact Mass | 399.06 |
| IUPAC Name | 4-fluoro-N-[1-(4-fluorophenyl)-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]benzamide |
| SMILES | O=C(NC1(C(F)(F)F)NC(=O)N(c2ccc(F)cc2)C1=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C17H10F5N3O3/c18-10-3-1-9(2-4-10)13(26)23-16(17(20,21)22)14(27)25(15(28)24-16)12-7-5-11(19)6-8-12/h1-8H,(H,23,26)(H,24,28) |
| InChIKey | USLPASJWIWBZPG-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.28 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|