C19H16F3N3O5 — CID 41062779
N-[(4R)-2,5-dioxo-1-phenyl-4-(trifluoromethyl)imidazolidin-4-yl]-3,4-dimethoxybenzamide (PubChem CID 41062779) has the molecular formula C19H16F3N3O5 and a molecular weight of 423.35 g/mol. Its IUPAC name is N-[(4R)-2,5-dioxo-1-phenyl-4-(trifluoromethyl)imidazolidin-4-yl]-3,4-dimethoxybenzamide.
| Compound Name | N-[(4R)-2,5-dioxo-1-phenyl-4-(trifluoromethyl)imidazolidin-4-yl]-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 41062779 |
| Molecular Formula | C19H16F3N3O5 |
| Molecular Weight | 423.35 g/mol |
| Exact Mass | 423.10 |
| IUPAC Name | N-[(4R)-2,5-dioxo-1-phenyl-4-(trifluoromethyl)imidazolidin-4-yl]-3,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)N[C@@]2(C(F)(F)F)NC(=O)N(c3ccccc3)C2=O)cc1OC |
| InChI | InChI=1S/C19H16F3N3O5/c1-29-13-9-8-11(10-14(13)30-2)15(26)23-18(19(20,21)22)16(27)25(17(28)24-18)12-6-4-3-5-7-12/h3-10H,1-2H3,(H,23,26)(H,24,28)/t18-/m1/s1 |
| InChIKey | AGDJUWDLCLCHHE-GOSISDBHSA-N |
| XLogP | 2.45 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.35 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|