C19H14ClF4N3O5 — CID 2021966
N-[(4S)-1-(3-chloro-4-fluorophenyl)-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]-3,4-dimethoxybenzamide (PubChem CID 2021966) has the molecular formula C19H14ClF4N3O5 and a molecular weight of 475.78 g/mol. Its IUPAC name is N-[(4S)-1-(3-chloro-4-fluorophenyl)-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]-3,4-dimethoxybenzamide.
| Compound Name | N-[(4S)-1-(3-chloro-4-fluorophenyl)-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 2021966 |
| Molecular Formula | C19H14ClF4N3O5 |
| Molecular Weight | 475.78 g/mol |
| Exact Mass | 475.06 |
| IUPAC Name | N-[(4S)-1-(3-chloro-4-fluorophenyl)-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]-3,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)N[C@]2(C(F)(F)F)NC(=O)N(c3ccc(F)c(Cl)c3)C2=O)cc1OC |
| InChI | InChI=1S/C19H14ClF4N3O5/c1-31-13-6-3-9(7-14(13)32-2)15(28)25-18(19(22,23)24)16(29)27(17(30)26-18)10-4-5-12(21)11(20)8-10/h3-8H,1-2H3,(H,25,28)(H,26,30)/t18-/m0/s1 |
| InChIKey | RQCAMWDSJQDHJW-SFHVURJKSA-N |
| XLogP | 3.24 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.78 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|