C18H13F4N3O4 — CID 3664545
N-[1-(4-fluorophenyl)-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]-3-methoxybenzamide (PubChem CID 3664545) has the molecular formula C18H13F4N3O4 and a molecular weight of 411.31 g/mol. Its IUPAC name is N-[1-(4-fluorophenyl)-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]-3-methoxybenzamide.
| Compound Name | N-[1-(4-fluorophenyl)-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]-3-methoxybenzamide |
|---|---|
| PubChem CID | 3664545 |
| Molecular Formula | C18H13F4N3O4 |
| Molecular Weight | 411.31 g/mol |
| Exact Mass | 411.08 |
| IUPAC Name | N-[1-(4-fluorophenyl)-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]-3-methoxybenzamide |
| SMILES | COc1cccc(C(=O)NC2(C(F)(F)F)NC(=O)N(c3ccc(F)cc3)C2=O)c1 |
| InChI | InChI=1S/C18H13F4N3O4/c1-29-13-4-2-3-10(9-13)14(26)23-17(18(20,21)22)15(27)25(16(28)24-17)12-7-5-11(19)6-8-12/h2-9H,1H3,(H,23,26)(H,24,28) |
| InChIKey | IOLWDDWAWPTDIT-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.31 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|