C21H20F3N3O5 — CID 92651760
N-[(4S)-1-(3,4-dimethylphenyl)-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]-3,4-dimethoxybenzamide (PubChem CID 92651760) has the molecular formula C21H20F3N3O5 and a molecular weight of 451.40 g/mol. Its IUPAC name is N-[(4S)-1-(3,4-dimethylphenyl)-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]-3,4-dimethoxybenzamide.
| Compound Name | N-[(4S)-1-(3,4-dimethylphenyl)-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 92651760 |
| Molecular Formula | C21H20F3N3O5 |
| Molecular Weight | 451.40 g/mol |
| Exact Mass | 451.14 |
| IUPAC Name | N-[(4S)-1-(3,4-dimethylphenyl)-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]-3,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)N[C@]2(C(F)(F)F)NC(=O)N(c3ccc(C)c(C)c3)C2=O)cc1OC |
| InChI | InChI=1S/C21H20F3N3O5/c1-11-5-7-14(9-12(11)2)27-18(29)20(21(22,23)24,26-19(27)30)25-17(28)13-6-8-15(31-3)16(10-13)32-4/h5-10H,1-4H3,(H,25,28)(H,26,30)/t20-/m0/s1 |
| InChIKey | WATNTDJWLQPKKF-FQEVSTJZSA-N |
| XLogP | 3.07 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.40 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|