C18H15F3N4O3 — CID 40946848
N-[(4R)-1-(3,4-dimethylphenyl)-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]pyridine-3-carboxamide (PubChem CID 40946848) has the molecular formula C18H15F3N4O3 and a molecular weight of 392.34 g/mol. Its IUPAC name is N-[(4R)-1-(3,4-dimethylphenyl)-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]pyridine-3-carboxamide.
| Compound Name | N-[(4R)-1-(3,4-dimethylphenyl)-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 40946848 |
| Molecular Formula | C18H15F3N4O3 |
| Molecular Weight | 392.34 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | N-[(4R)-1-(3,4-dimethylphenyl)-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]pyridine-3-carboxamide |
| SMILES | Cc1ccc(N2C(=O)N[C@@](NC(=O)c3cccnc3)(C(F)(F)F)C2=O)cc1C |
| InChI | InChI=1S/C18H15F3N4O3/c1-10-5-6-13(8-11(10)2)25-15(27)17(18(19,20)21,24-16(25)28)23-14(26)12-4-3-7-22-9-12/h3-9H,1-2H3,(H,23,26)(H,24,28)/t17-/m1/s1 |
| InChIKey | UARDRXJJOMMLET-QGZVFWFLSA-N |
| XLogP | 2.44 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.34 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|