C18H15F3N4O3 — CID 41064433
N-[(4S)-2,5-dioxo-1-(pyridin-3-ylmethyl)-4-(trifluoromethyl)imidazolidin-4-yl]-4-methylbenzamide (PubChem CID 41064433) has the molecular formula C18H15F3N4O3 and a molecular weight of 392.34 g/mol. Its IUPAC name is N-[(4S)-2,5-dioxo-1-(pyridin-3-ylmethyl)-4-(trifluoromethyl)imidazolidin-4-yl]-4-methylbenzamide.
| Compound Name | N-[(4S)-2,5-dioxo-1-(pyridin-3-ylmethyl)-4-(trifluoromethyl)imidazolidin-4-yl]-4-methylbenzamide |
|---|---|
| PubChem CID | 41064433 |
| Molecular Formula | C18H15F3N4O3 |
| Molecular Weight | 392.34 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | N-[(4S)-2,5-dioxo-1-(pyridin-3-ylmethyl)-4-(trifluoromethyl)imidazolidin-4-yl]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)N[C@]2(C(F)(F)F)NC(=O)N(Cc3cccnc3)C2=O)cc1 |
| InChI | InChI=1S/C18H15F3N4O3/c1-11-4-6-13(7-5-11)14(26)23-17(18(19,20)21)15(27)25(16(28)24-17)10-12-3-2-8-22-9-12/h2-9H,10H2,1H3,(H,23,26)(H,24,28)/t17-/m0/s1 |
| InChIKey | JALAIZGXYSIUIL-KRWDZBQOSA-N |
| XLogP | 2.13 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.34 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|