C17H13F3N4O3 — CID 7044627
N-[(4S)-1-benzyl-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]pyridine-3-carboxamide (PubChem CID 7044627) has the molecular formula C17H13F3N4O3 and a molecular weight of 378.31 g/mol. Its IUPAC name is N-[(4S)-1-benzyl-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]pyridine-3-carboxamide.
| Compound Name | N-[(4S)-1-benzyl-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 7044627 |
| Molecular Formula | C17H13F3N4O3 |
| Molecular Weight | 378.31 g/mol |
| Exact Mass | 378.09 |
| IUPAC Name | N-[(4S)-1-benzyl-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]pyridine-3-carboxamide |
| SMILES | O=C(N[C@]1(C(F)(F)F)NC(=O)N(Cc2ccccc2)C1=O)c1cccnc1 |
| InChI | InChI=1S/C17H13F3N4O3/c18-17(19,20)16(22-13(25)12-7-4-8-21-9-12)14(26)24(15(27)23-16)10-11-5-2-1-3-6-11/h1-9H,10H2,(H,22,25)(H,23,27)/t16-/m0/s1 |
| InChIKey | XIVWBRCSNZCCJC-INIZCTEOSA-N |
| XLogP | 1.82 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.31 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|