C19H23F3N4O3 — CID 3721563
3-cyclohexyl-N-[2,5-dioxo-1-(pyridin-3-ylmethyl)-4-(trifluoromethyl)imidazolidin-4-yl]propanamide (PubChem CID 3721563) has the molecular formula C19H23F3N4O3 and a molecular weight of 412.41 g/mol. Its IUPAC name is 3-cyclohexyl-N-[2,5-dioxo-1-(pyridin-3-ylmethyl)-4-(trifluoromethyl)imidazolidin-4-yl]propanamide.
| Compound Name | 3-cyclohexyl-N-[2,5-dioxo-1-(pyridin-3-ylmethyl)-4-(trifluoromethyl)imidazolidin-4-yl]propanamide |
|---|---|
| PubChem CID | 3721563 |
| Molecular Formula | C19H23F3N4O3 |
| Molecular Weight | 412.41 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | 3-cyclohexyl-N-[2,5-dioxo-1-(pyridin-3-ylmethyl)-4-(trifluoromethyl)imidazolidin-4-yl]propanamide |
| SMILES | O=C(CCC1CCCCC1)NC1(C(F)(F)F)NC(=O)N(Cc2cccnc2)C1=O |
| InChI | InChI=1S/C19H23F3N4O3/c20-19(21,22)18(24-15(27)9-8-13-5-2-1-3-6-13)16(28)26(17(29)25-18)12-14-7-4-10-23-11-14/h4,7,10-11,13H,1-3,5-6,8-9,12H2,(H,24,27)(H,25,29) |
| InChIKey | QJKFNFVWGVFUBU-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.41 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|