C18H20F3N3O3 — CID 41062638
N-[(4R)-1-cyclohexyl-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]-2-phenylacetamide (PubChem CID 41062638) has the molecular formula C18H20F3N3O3 and a molecular weight of 383.37 g/mol. Its IUPAC name is N-[(4R)-1-cyclohexyl-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]-2-phenylacetamide.
| Compound Name | N-[(4R)-1-cyclohexyl-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]-2-phenylacetamide |
|---|---|
| PubChem CID | 41062638 |
| Molecular Formula | C18H20F3N3O3 |
| Molecular Weight | 383.37 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | N-[(4R)-1-cyclohexyl-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]-2-phenylacetamide |
| SMILES | O=C(Cc1ccccc1)N[C@@]1(C(F)(F)F)NC(=O)N(C2CCCCC2)C1=O |
| InChI | InChI=1S/C18H20F3N3O3/c19-18(20,21)17(22-14(25)11-12-7-3-1-4-8-12)15(26)24(16(27)23-17)13-9-5-2-6-10-13/h1,3-4,7-8,13H,2,5-6,9-11H2,(H,22,25)(H,23,27)/t17-/m1/s1 |
| InChIKey | XQNZKSGJBNILCD-QGZVFWFLSA-N |
| XLogP | 2.49 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.37 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|