C20H24F3N3O3 — CID 42578055
4-tert-butyl-N-[(4R)-1-cyclopentyl-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]benzamide (PubChem CID 42578055) has the molecular formula C20H24F3N3O3 and a molecular weight of 411.42 g/mol. Its IUPAC name is 4-tert-butyl-N-[(4R)-1-cyclopentyl-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]benzamide.
| Compound Name | 4-tert-butyl-N-[(4R)-1-cyclopentyl-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]benzamide |
|---|---|
| PubChem CID | 42578055 |
| Molecular Formula | C20H24F3N3O3 |
| Molecular Weight | 411.42 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | 4-tert-butyl-N-[(4R)-1-cyclopentyl-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]benzamide |
| SMILES | CC(C)(C)c1ccc(C(=O)N[C@@]2(C(F)(F)F)NC(=O)N(C3CCCC3)C2=O)cc1 |
| InChI | InChI=1S/C20H24F3N3O3/c1-18(2,3)13-10-8-12(9-11-13)15(27)24-19(20(21,22)23)16(28)26(17(29)25-19)14-6-4-5-7-14/h8-11,14H,4-7H2,1-3H3,(H,24,27)(H,25,29)/t19-/m1/s1 |
| InChIKey | ICUCIELICHLVMF-LJQANCHMSA-N |
| XLogP | 3.47 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.42 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|