C20H24F3N3O5 — CID 2002483
N-[(4S)-1-cycloheptyl-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]-2,4-dimethoxybenzamide (PubChem CID 2002483) has the molecular formula C20H24F3N3O5 and a molecular weight of 443.42 g/mol. Its IUPAC name is N-[(4S)-1-cycloheptyl-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]-2,4-dimethoxybenzamide.
| Compound Name | N-[(4S)-1-cycloheptyl-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]-2,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 2002483 |
| Molecular Formula | C20H24F3N3O5 |
| Molecular Weight | 443.42 g/mol |
| Exact Mass | 443.17 |
| IUPAC Name | N-[(4S)-1-cycloheptyl-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]-2,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)N[C@]2(C(F)(F)F)NC(=O)N(C3CCCCCC3)C2=O)c(OC)c1 |
| InChI | InChI=1S/C20H24F3N3O5/c1-30-13-9-10-14(15(11-13)31-2)16(27)24-19(20(21,22)23)17(28)26(18(29)25-19)12-7-5-3-4-6-8-12/h9-12H,3-8H2,1-2H3,(H,24,27)(H,25,29)/t19-/m0/s1 |
| InChIKey | ZLOUTLITQNLZHB-IBGZPJMESA-N |
| XLogP | 2.97 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.42 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|