C15H19F2NO3 — CID 119104693
N-(4,4-difluorocyclohexyl)-2,4-dimethoxybenzamide (PubChem CID 119104693) has the molecular formula C15H19F2NO3 and a molecular weight of 299.32 g/mol. Its IUPAC name is N-(4,4-difluorocyclohexyl)-2,4-dimethoxybenzamide.
| Compound Name | N-(4,4-difluorocyclohexyl)-2,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 119104693 |
| Molecular Formula | C15H19F2NO3 |
| Molecular Weight | 299.32 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | N-(4,4-difluorocyclohexyl)-2,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)NC2CCC(F)(F)CC2)c(OC)c1 |
| InChI | InChI=1S/C15H19F2NO3/c1-20-11-3-4-12(13(9-11)21-2)14(19)18-10-5-7-15(16,17)8-6-10/h3-4,9-10H,5-8H2,1-2H3,(H,18,19) |
| InChIKey | CJESPPSWALTCLN-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.32 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |