C21H26F3N3O4 — CID 2016032
N-[(4R)-1-cycloheptyl-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]-4-propan-2-yloxybenzamide (PubChem CID 2016032) has the molecular formula C21H26F3N3O4 and a molecular weight of 441.45 g/mol. Its IUPAC name is N-[(4R)-1-cycloheptyl-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]-4-propan-2-yloxybenzamide.
| Compound Name | N-[(4R)-1-cycloheptyl-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]-4-propan-2-yloxybenzamide |
|---|---|
| PubChem CID | 2016032 |
| Molecular Formula | C21H26F3N3O4 |
| Molecular Weight | 441.45 g/mol |
| Exact Mass | 441.19 |
| IUPAC Name | N-[(4R)-1-cycloheptyl-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]-4-propan-2-yloxybenzamide |
| SMILES | CC(C)Oc1ccc(C(=O)N[C@@]2(C(F)(F)F)NC(=O)N(C3CCCCCC3)C2=O)cc1 |
| InChI | InChI=1S/C21H26F3N3O4/c1-13(2)31-16-11-9-14(10-12-16)17(28)25-20(21(22,23)24)18(29)27(19(30)26-20)15-7-5-3-4-6-8-15/h9-13,15H,3-8H2,1-2H3,(H,25,28)(H,26,30)/t20-/m1/s1 |
| InChIKey | AZTSYTGQLTXUKG-HXUWFJFHSA-N |
| XLogP | 3.74 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.45 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|