C28H38N2O2 — CID 7311333
4-tert-butyl-N-[(1R,2S)-2-[(4-tert-butylbenzoyl)amino]cyclohexyl]benzamide (PubChem CID 7311333) has the molecular formula C28H38N2O2 and a molecular weight of 434.62 g/mol. Its IUPAC name is 4-tert-butyl-N-[(1R,2S)-2-[(4-tert-butylbenzoyl)amino]cyclohexyl]benzamide.
| Compound Name | 4-tert-butyl-N-[(1R,2S)-2-[(4-tert-butylbenzoyl)amino]cyclohexyl]benzamide |
|---|---|
| PubChem CID | 7311333 |
| Molecular Formula | C28H38N2O2 |
| Molecular Weight | 434.62 g/mol |
| Exact Mass | 434.29 |
| IUPAC Name | 4-tert-butyl-N-[(1R,2S)-2-[(4-tert-butylbenzoyl)amino]cyclohexyl]benzamide |
| SMILES | CC(C)(C)c1ccc(C(=O)N[C@H]2CCCC[C@H]2NC(=O)c2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C28H38N2O2/c1-27(2,3)21-15-11-19(12-16-21)25(31)29-23-9-7-8-10-24(23)30-26(32)20-13-17-22(18-14-20)28(4,5)6/h11-18,23-24H,7-10H2,1-6H3,(H,29,31)(H,30,32)/t23-,24+ |
| InChIKey | QUCBRXBTRUSUBQ-PSWAGMNNSA-N |
| XLogP | 5.75 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.62 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |