C17H24INO — CID 63525981
N-(2-tert-butylcyclohexyl)-4-iodobenzamide (PubChem CID 63525981) has the molecular formula C17H24INO and a molecular weight of 385.29 g/mol. Its IUPAC name is N-(2-tert-butylcyclohexyl)-4-iodobenzamide.
| Compound Name | N-(2-tert-butylcyclohexyl)-4-iodobenzamide |
|---|---|
| PubChem CID | 63525981 |
| Molecular Formula | C17H24INO |
| Molecular Weight | 385.29 g/mol |
| Exact Mass | 385.09 |
| IUPAC Name | N-(2-tert-butylcyclohexyl)-4-iodobenzamide |
| SMILES | CC(C)(C)C1CCCCC1NC(=O)c1ccc(I)cc1 |
| InChI | InChI=1S/C17H24INO/c1-17(2,3)14-6-4-5-7-15(14)19-16(20)12-8-10-13(18)11-9-12/h8-11,14-15H,4-7H2,1-3H3,(H,19,20) |
| InChIKey | IDKFLWZQDZSDNO-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.29 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|