C17H23BrClNO — CID 107999351
3-bromo-N-(2-tert-butylcyclohexyl)-4-chlorobenzamide (PubChem CID 107999351) has the molecular formula C17H23BrClNO and a molecular weight of 372.73 g/mol. Its IUPAC name is 3-bromo-N-(2-tert-butylcyclohexyl)-4-chlorobenzamide.
| Compound Name | 3-bromo-N-(2-tert-butylcyclohexyl)-4-chlorobenzamide |
|---|---|
| PubChem CID | 107999351 |
| Molecular Formula | C17H23BrClNO |
| Molecular Weight | 372.73 g/mol |
| Exact Mass | 371.07 |
| IUPAC Name | 3-bromo-N-(2-tert-butylcyclohexyl)-4-chlorobenzamide |
| SMILES | CC(C)(C)C1CCCCC1NC(=O)c1ccc(Cl)c(Br)c1 |
| InChI | InChI=1S/C17H23BrClNO/c1-17(2,3)12-6-4-5-7-15(12)20-16(21)11-8-9-14(19)13(18)10-11/h8-10,12,15H,4-7H2,1-3H3,(H,20,21) |
| InChIKey | JZAXCTLQEMQDBR-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.73 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |