C18H27NO3S — CID 39634709
N-[(1S,2S)-2-tert-butylcyclohexyl]-3-methylsulfonylbenzamide (PubChem CID 39634709) has the molecular formula C18H27NO3S and a molecular weight of 337.49 g/mol. Its IUPAC name is N-[(1S,2S)-2-tert-butylcyclohexyl]-3-methylsulfonylbenzamide.
| Compound Name | N-[(1S,2S)-2-tert-butylcyclohexyl]-3-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 39634709 |
| Molecular Formula | C18H27NO3S |
| Molecular Weight | 337.49 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | N-[(1S,2S)-2-tert-butylcyclohexyl]-3-methylsulfonylbenzamide |
| SMILES | CC(C)(C)[C@@H]1CCCC[C@@H]1NC(=O)c1cccc(S(C)(=O)=O)c1 |
| InChI | InChI=1S/C18H27NO3S/c1-18(2,3)15-10-5-6-11-16(15)19-17(20)13-8-7-9-14(12-13)23(4,21)22/h7-9,12,15-16H,5-6,10-11H2,1-4H3,(H,19,20)/t15-,16+/m1/s1 |
| InChIKey | NOEGQCYIIUXASD-CVEARBPZSA-N |
| XLogP | 3.42 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.49 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |