C13H16N2O3S — CID 98318394
N-[(1R,5R)-3-azabicyclo[3.1.0]hexan-6-yl]-3-methylsulfonylbenzamide (PubChem CID 98318394) has the molecular formula C13H16N2O3S and a molecular weight of 280.35 g/mol. Its IUPAC name is N-[(1R,5R)-3-azabicyclo[3.1.0]hexan-6-yl]-3-methylsulfonylbenzamide.
| Compound Name | N-[(1R,5R)-3-azabicyclo[3.1.0]hexan-6-yl]-3-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 98318394 |
| Molecular Formula | C13H16N2O3S |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | N-[(1R,5R)-3-azabicyclo[3.1.0]hexan-6-yl]-3-methylsulfonylbenzamide |
| SMILES | CS(=O)(=O)c1cccc(C(=O)NC2[C@H]3CNC[C@H]23)c1 |
| InChI | InChI=1S/C13H16N2O3S/c1-19(17,18)9-4-2-3-8(5-9)13(16)15-12-10-6-14-7-11(10)12/h2-5,10-12,14H,6-7H2,1H3,(H,15,16)/t10-,11-/m0/s1 |
| InChIKey | SNNVOBAWUAPGKI-QWRGUYRKSA-N |
| XLogP | 0.04 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |