C19H30N2O3S — CID 55582577
N-(2-tert-butylcyclohexyl)-3-(methanesulfonamido)-4-methylbenzamide (PubChem CID 55582577) has the molecular formula C19H30N2O3S and a molecular weight of 366.53 g/mol. Its IUPAC name is N-(2-tert-butylcyclohexyl)-3-(methanesulfonamido)-4-methylbenzamide.
| Compound Name | N-(2-tert-butylcyclohexyl)-3-(methanesulfonamido)-4-methylbenzamide |
|---|---|
| PubChem CID | 55582577 |
| Molecular Formula | C19H30N2O3S |
| Molecular Weight | 366.53 g/mol |
| Exact Mass | 366.20 |
| IUPAC Name | N-(2-tert-butylcyclohexyl)-3-(methanesulfonamido)-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)NC2CCCCC2C(C)(C)C)cc1NS(C)(=O)=O |
| InChI | InChI=1S/C19H30N2O3S/c1-13-10-11-14(12-17(13)21-25(5,23)24)18(22)20-16-9-7-6-8-15(16)19(2,3)4/h10-12,15-16,21H,6-9H2,1-5H3,(H,20,22) |
| InChIKey | DATNUYLJFSASSL-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.53 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |