C11H12INO — CID 58185353
4-iodo-N-(2-methylcyclopropyl)benzamide (PubChem CID 58185353) has the molecular formula C11H12INO and a molecular weight of 301.13 g/mol. Its IUPAC name is 4-iodo-N-(2-methylcyclopropyl)benzamide.
| Compound Name | 4-iodo-N-(2-methylcyclopropyl)benzamide |
|---|---|
| PubChem CID | 58185353 |
| Molecular Formula | C11H12INO |
| Molecular Weight | 301.13 g/mol |
| Exact Mass | 301.00 |
| IUPAC Name | 4-iodo-N-(2-methylcyclopropyl)benzamide |
| SMILES | CC1CC1NC(=O)c1ccc(I)cc1 |
| InChI | InChI=1S/C11H12INO/c1-7-6-10(7)13-11(14)8-2-4-9(12)5-3-8/h2-5,7,10H,6H2,1H3,(H,13,14) |
| InChIKey | YVTQJJAQOWFFLN-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.13 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|