C16H22N2OS — CID 63999184
4-carbamothioyl-N-(2,4-dimethylcyclohexyl)benzamide (PubChem CID 63999184) has the molecular formula C16H22N2OS and a molecular weight of 290.43 g/mol. Its IUPAC name is 4-carbamothioyl-N-(2,4-dimethylcyclohexyl)benzamide.
| Compound Name | 4-carbamothioyl-N-(2,4-dimethylcyclohexyl)benzamide |
|---|---|
| PubChem CID | 63999184 |
| Molecular Formula | C16H22N2OS |
| Molecular Weight | 290.43 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | 4-carbamothioyl-N-(2,4-dimethylcyclohexyl)benzamide |
| SMILES | CC1CCC(NC(=O)c2ccc(C(N)=S)cc2)C(C)C1 |
| InChI | InChI=1S/C16H22N2OS/c1-10-3-8-14(11(2)9-10)18-16(19)13-6-4-12(5-7-13)15(17)20/h4-7,10-11,14H,3,8-9H2,1-2H3,(H2,17,20)(H,18,19) |
| InChIKey | WKVQTDHEHVFZPB-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.43 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|