C13H18BrNOS — CID 63999980
5-bromo-N-(2,4-dimethylcyclohexyl)thiophene-3-carboxamide (PubChem CID 63999980) has the molecular formula C13H18BrNOS and a molecular weight of 316.26 g/mol. Its IUPAC name is 5-bromo-N-(2,4-dimethylcyclohexyl)thiophene-3-carboxamide.
| Compound Name | 5-bromo-N-(2,4-dimethylcyclohexyl)thiophene-3-carboxamide |
|---|---|
| PubChem CID | 63999980 |
| Molecular Formula | C13H18BrNOS |
| Molecular Weight | 316.26 g/mol |
| Exact Mass | 315.03 |
| IUPAC Name | 5-bromo-N-(2,4-dimethylcyclohexyl)thiophene-3-carboxamide |
| SMILES | CC1CCC(NC(=O)c2csc(Br)c2)C(C)C1 |
| InChI | InChI=1S/C13H18BrNOS/c1-8-3-4-11(9(2)5-8)15-13(16)10-6-12(14)17-7-10/h6-9,11H,3-5H2,1-2H3,(H,15,16) |
| InChIKey | CAGNDGSPYYGMIU-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.26 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |