C15H19BrClNO — CID 63998181
5-bromo-2-chloro-N-(2,4-dimethylcyclohexyl)benzamide (PubChem CID 63998181) has the molecular formula C15H19BrClNO and a molecular weight of 344.68 g/mol. Its IUPAC name is 5-bromo-2-chloro-N-(2,4-dimethylcyclohexyl)benzamide.
| Compound Name | 5-bromo-2-chloro-N-(2,4-dimethylcyclohexyl)benzamide |
|---|---|
| PubChem CID | 63998181 |
| Molecular Formula | C15H19BrClNO |
| Molecular Weight | 344.68 g/mol |
| Exact Mass | 343.03 |
| IUPAC Name | 5-bromo-2-chloro-N-(2,4-dimethylcyclohexyl)benzamide |
| SMILES | CC1CCC(NC(=O)c2cc(Br)ccc2Cl)C(C)C1 |
| InChI | InChI=1S/C15H19BrClNO/c1-9-3-6-14(10(2)7-9)18-15(19)12-8-11(16)4-5-13(12)17/h4-5,8-10,14H,3,6-7H2,1-2H3,(H,18,19) |
| InChIKey | UUPIPTABJTYDOA-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.68 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |