C16H22FNO — CID 113268698
N-(2,4-dimethylcyclohexyl)-4-fluoro-2-methylbenzamide (PubChem CID 113268698) has the molecular formula C16H22FNO and a molecular weight of 263.36 g/mol. Its IUPAC name is N-(2,4-dimethylcyclohexyl)-4-fluoro-2-methylbenzamide.
| Compound Name | N-(2,4-dimethylcyclohexyl)-4-fluoro-2-methylbenzamide |
|---|---|
| PubChem CID | 113268698 |
| Molecular Formula | C16H22FNO |
| Molecular Weight | 263.36 g/mol |
| Exact Mass | 263.17 |
| IUPAC Name | N-(2,4-dimethylcyclohexyl)-4-fluoro-2-methylbenzamide |
| SMILES | Cc1cc(F)ccc1C(=O)NC1CCC(C)CC1C |
| InChI | InChI=1S/C16H22FNO/c1-10-4-7-15(12(3)8-10)18-16(19)14-6-5-13(17)9-11(14)2/h5-6,9-10,12,15H,4,7-8H2,1-3H3,(H,18,19) |
| InChIKey | WMDOYVQCAUMCNY-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.36 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |