C15H20ClNO2 — CID 63999982
4-chloro-N-(2,4-dimethylcyclohexyl)-2-hydroxybenzamide (PubChem CID 63999982) has the molecular formula C15H20ClNO2 and a molecular weight of 281.78 g/mol. Its IUPAC name is 4-chloro-N-(2,4-dimethylcyclohexyl)-2-hydroxybenzamide.
| Compound Name | 4-chloro-N-(2,4-dimethylcyclohexyl)-2-hydroxybenzamide |
|---|---|
| PubChem CID | 63999982 |
| Molecular Formula | C15H20ClNO2 |
| Molecular Weight | 281.78 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | 4-chloro-N-(2,4-dimethylcyclohexyl)-2-hydroxybenzamide |
| SMILES | CC1CCC(NC(=O)c2ccc(Cl)cc2O)C(C)C1 |
| InChI | InChI=1S/C15H20ClNO2/c1-9-3-6-13(10(2)7-9)17-15(19)12-5-4-11(16)8-14(12)18/h4-5,8-10,13,18H,3,6-7H2,1-2H3,(H,17,19) |
| InChIKey | SGNLKFYETJNIBN-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.78 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |