C17H24N2O — CID 103998982
N-(2,4-dimethylcyclohexyl)-2,3-dihydro-1H-isoindole-5-carboxamide (PubChem CID 103998982) has the molecular formula C17H24N2O and a molecular weight of 272.39 g/mol. Its IUPAC name is N-(2,4-dimethylcyclohexyl)-2,3-dihydro-1H-isoindole-5-carboxamide.
| Compound Name | N-(2,4-dimethylcyclohexyl)-2,3-dihydro-1H-isoindole-5-carboxamide |
|---|---|
| PubChem CID | 103998982 |
| Molecular Formula | C17H24N2O |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.19 |
| IUPAC Name | N-(2,4-dimethylcyclohexyl)-2,3-dihydro-1H-isoindole-5-carboxamide |
| SMILES | CC1CCC(NC(=O)c2ccc3c(c2)CNC3)C(C)C1 |
| InChI | InChI=1S/C17H24N2O/c1-11-3-6-16(12(2)7-11)19-17(20)13-4-5-14-9-18-10-15(14)8-13/h4-5,8,11-12,16,18H,3,6-7,9-10H2,1-2H3,(H,19,20) |
| InChIKey | IELKHTPGOQLQGJ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |