C13H20N2OS — CID 63996432
3-amino-N-(2,4-dimethylcyclohexyl)thiophene-2-carboxamide (PubChem CID 63996432) has the molecular formula C13H20N2OS and a molecular weight of 252.38 g/mol. Its IUPAC name is 3-amino-N-(2,4-dimethylcyclohexyl)thiophene-2-carboxamide.
| Compound Name | 3-amino-N-(2,4-dimethylcyclohexyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 63996432 |
| Molecular Formula | C13H20N2OS |
| Molecular Weight | 252.38 g/mol |
| Exact Mass | 252.13 |
| IUPAC Name | 3-amino-N-(2,4-dimethylcyclohexyl)thiophene-2-carboxamide |
| SMILES | CC1CCC(NC(=O)c2sccc2N)C(C)C1 |
| InChI | InChI=1S/C13H20N2OS/c1-8-3-4-11(9(2)7-8)15-13(16)12-10(14)5-6-17-12/h5-6,8-9,11H,3-4,7,14H2,1-2H3,(H,15,16) |
| InChIKey | GCMMAAUGUIFPCG-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.38 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |