C17H26N2O2 — CID 81395055
2-amino-N-(2,4-dimethylcyclohexyl)-6-ethoxybenzamide (PubChem CID 81395055) has the molecular formula C17H26N2O2 and a molecular weight of 290.41 g/mol. Its IUPAC name is 2-amino-N-(2,4-dimethylcyclohexyl)-6-ethoxybenzamide.
| Compound Name | 2-amino-N-(2,4-dimethylcyclohexyl)-6-ethoxybenzamide |
|---|---|
| PubChem CID | 81395055 |
| Molecular Formula | C17H26N2O2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.20 |
| IUPAC Name | 2-amino-N-(2,4-dimethylcyclohexyl)-6-ethoxybenzamide |
| SMILES | CCOc1cccc(N)c1C(=O)NC1CCC(C)CC1C |
| InChI | InChI=1S/C17H26N2O2/c1-4-21-15-7-5-6-13(18)16(15)17(20)19-14-9-8-11(2)10-12(14)3/h5-7,11-12,14H,4,8-10,18H2,1-3H3,(H,19,20) |
| InChIKey | KSWOUFLQYATHOU-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|