C13H16N2O4S — CID 81420200
2-amino-N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-6-ethoxybenzamide (PubChem CID 81420200) has the molecular formula C13H16N2O4S and a molecular weight of 296.35 g/mol. Its IUPAC name is 2-amino-N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-6-ethoxybenzamide.
| Compound Name | 2-amino-N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-6-ethoxybenzamide |
|---|---|
| PubChem CID | 81420200 |
| Molecular Formula | C13H16N2O4S |
| Molecular Weight | 296.35 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | 2-amino-N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-6-ethoxybenzamide |
| SMILES | CCOc1cccc(N)c1C(=O)NC1C=CS(=O)(=O)C1 |
| InChI | InChI=1S/C13H16N2O4S/c1-2-19-11-5-3-4-10(14)12(11)13(16)15-9-6-7-20(17,18)8-9/h3-7,9H,2,8,14H2,1H3,(H,15,16) |
| InChIKey | YMLPFAMOOINZTI-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.35 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|