C15H13ClF3N3O3 — CID 41062663
N-[(4S)-1-[(2-chlorophenyl)methyl]-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]cyclopropanecarboxamide (PubChem CID 41062663) has the molecular formula C15H13ClF3N3O3 and a molecular weight of 375.73 g/mol. Its IUPAC name is N-[(4S)-1-[(2-chlorophenyl)methyl]-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]cyclopropanecarboxamide.
| Compound Name | N-[(4S)-1-[(2-chlorophenyl)methyl]-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 41062663 |
| Molecular Formula | C15H13ClF3N3O3 |
| Molecular Weight | 375.73 g/mol |
| Exact Mass | 375.06 |
| IUPAC Name | N-[(4S)-1-[(2-chlorophenyl)methyl]-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]cyclopropanecarboxamide |
| SMILES | O=C(N[C@]1(C(F)(F)F)NC(=O)N(Cc2ccccc2Cl)C1=O)C1CC1 |
| InChI | InChI=1S/C15H13ClF3N3O3/c16-10-4-2-1-3-9(10)7-22-12(24)14(15(17,18)19,21-13(22)25)20-11(23)8-5-6-8/h1-4,8H,5-7H2,(H,20,23)(H,21,25)/t14-/m0/s1 |
| InChIKey | MWJHVFVBHPJTFI-AWEZNQCLSA-N |
| XLogP | 2.18 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.73 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|